Difference between revisions of "RXN-17786"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17786 RXN-17786] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17786 RXN-17786] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 6-phosphogluconate dehydrogenase, C-terminal-like |
− | * | + | ** 3-hydroxyacyl-CoA dehydrogenase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[NAD]][c] '''+''' 1 [[CPD-19159]][c] '''=>''' 1 [[CPD-19160]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 NAD+[c] '''+''' 1 (S)-3-hydroxy-(11Z)-octadecenoyl-CoA[c] '''=>''' 1 3-oxo-(11Z)-octadecenoyl-CoA[c] '''+''' 1 H+[c] '''+''' 1 NADH[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-19_005290]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Ec-14_006530]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}} | |
− | + | {{#set: common name=3-hydroxyacyl-CoA dehydrogenase}} | |
− | + | {{#set: ec number=EC-1.1.1.35}} | |
− | + | {{#set: gene associated=Ec-19_005290|Ec-14_006530}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Contents
Reaction RXN-17786
- direction:
- LEFT-TO-RIGHT
- common name:
- 6-phosphogluconate dehydrogenase, C-terminal-like
- 3-hydroxyacyl-CoA dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 NAD+[c] + 1 (S)-3-hydroxy-(11Z)-octadecenoyl-CoA[c] => 1 3-oxo-(11Z)-octadecenoyl-CoA[c] + 1 H+[c] + 1 NADH[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-19_005290
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
- Gene: Ec-14_006530
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome