Difference between revisions of "PANTOTHENATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl5-N-acetyl-glucosamine2-R Mannosyl5-N-acetyl-glucosamine2-R] == * common name: ** a (ma...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == * smiles: ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] * inchi key: ** InChI...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTOTHENATE PANTOTHENATE] == |
+ | * smiles: | ||
+ | ** CC(C)(CO)C(O)C(=O)NCCC(=O)[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-pantothenate |
+ | * molecular weight: | ||
+ | ** 218.229 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** vitamin B5 | ||
+ | ** (R)-pantothenic acid | ||
+ | ** D-pantothenic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PANTOTHENATE-KIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PANTOATE-BETA-ALANINE-LIG-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 79-83-4 |
− | {{#set: consumed by= | + | * Wikipedia : Vitamin_B5 |
− | {{#set: produced by= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167945 167945] | ||
+ | * HMDB : HMDB00210 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00864 C00864] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.146912.html 146912] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29032 29032] | ||
+ | * BIGG : 36234 | ||
+ | {{#set: smiles=CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M}} | ||
+ | {{#set: common name=(R)-pantothenate}} | ||
+ | {{#set: molecular weight=218.229 }} | ||
+ | {{#set: common name=vitamin B5|(R)-pantothenic acid|D-pantothenic acid}} | ||
+ | {{#set: consumed by=PANTOTHENATE-KIN-RXN}} | ||
+ | {{#set: produced by=PANTOATE-BETA-ALANINE-LIG-RXN}} |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite PANTOTHENATE
- smiles:
- CC(C)(CO)C(O)C(=O)NCCC(=O)[O-]
- inchi key:
- InChIKey=GHOKWGTUZJEAQD-ZETCQYMHSA-M
- common name:
- (R)-pantothenate
- molecular weight:
- 218.229
- Synonym(s):
- vitamin B5
- (R)-pantothenic acid
- D-pantothenic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 79-83-4
- Wikipedia : Vitamin_B5
- PUBCHEM:
- HMDB : HMDB00210
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 36234
"CC(C)(CO)C(O)C(=O)NCCC(=O)[O-" cannot be used as a page name in this wiki.