Difference between revisions of "CPD-1828"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-21_001630 == * left end position: ** 2652811 * transcription direction: ** NEGATIVE * right end position: ** 2660003 * centisome position: ** 35.9...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-21_001630 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] ==
−
* left end position:
+
* smiles:
−
** 2652811
+
** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K
−
* right end position:
+
* common name:
−
** 2660003
+
** GDP-α-D-mannuronate
−
* centisome position:
+
* molecular weight:
−
** 35.945366    
+
** 616.305    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0147_0011
+
** GDP-mannuronic acid
−
** Esi0147_0011
+
** GDP-α-D-mannuronic acid
−
** Ser Thr PK
+
** GDP-mannuronate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2652811}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966153 11966153]
−
{{#set: right end position=2660003}}
+
* CHEMSPIDER:
−
{{#set: centisome position=35.945366   }}
+
** [http://www.chemspider.com/Chemical-Structure.10140147.html 10140147]
−
{{#set: common name=Esi_0147_0011|Esi0147_0011|Ser Thr PK}}
+
* CHEBI:
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17466 17466]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00976 C00976]
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))}}
 +
{{#set: inchi key=InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K}}
 +
{{#set: common name=GDP-α-D-mannuronate}}
 +
{{#set: molecular weight=616.305   }}
 +
{{#set: common name=GDP-mannuronic acid|GDP-α-D-mannuronic acid|GDP-mannuronate}}
 +
{{#set: produced by=GDP-MANNOSE-6-DEHYDROGENASE-RXN}}

Latest revision as of 19:48, 21 March 2018

Metabolite CPD-1828

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))
  • inchi key:
    • InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K
  • common name:
    • GDP-α-D-mannuronate
  • molecular weight:
    • 616.305
  • Synonym(s):
    • GDP-mannuronic acid
    • GDP-α-D-mannuronic acid
    • GDP-mannuronate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-1828&oldid=29486"