Difference between revisions of "Mannosyl5-N-acetyl-glucosamine2-R"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl5-N-acetyl-glucosamine2-R Mannosyl5-N-acetyl-glucosamine2-R] == * common name: ** a (ma...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Mannosyl5-N-acetyl-glucosamine2-R Mannosyl5-N-acetyl-glucosamine2-R] ==
−
* smiles:
+
−
** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O
+
−
* inchi key:
+
−
** InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** paraoxon
+
** a (mannosyl)5-(N-acetylglucosaminyl)-N-glycan
−
* molecular weight:
+
−
** 275.197   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O,O-diethyl-O-p-nitrophenylphosphoric acid
 
−
** diethyl-p-nitrophenyl phosphate
 
−
** phosphoric acid diethyl 4-nitrophenyl ester
 
−
** diethyl paraoxon
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-8746]]
+
* [[3.2.1.114-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.101-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 311-45-5
+
{{#set: common name=a (mannosyl)5-(N-acetylglucosaminyl)-N-glycan}}
−
* PUBCHEM:
+
{{#set: consumed by=3.2.1.114-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9395 9395]
+
{{#set: produced by=2.4.1.101-RXN}}
−
* HMDB : HMDB13035
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C06606 C06606]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.9026.html 9026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27827 27827]
+
−
{{#set: smiles=CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O}}
+
−
{{#set: inchi key=InChIKey=WYMSBXTXOHUIGT-UHFFFAOYSA-N}}
+
−
{{#set: common name=paraoxon}}
+
−
{{#set: molecular weight=275.197    }}
+
−
{{#set: common name=O,O-diethyl-O-p-nitrophenylphosphoric acid|diethyl-p-nitrophenyl phosphate|phosphoric acid diethyl 4-nitrophenyl ester|diethyl paraoxon}}
+
−
{{#set: consumed by=RXN-8746}}
+

Latest revision as of 19:48, 21 March 2018

Metabolite Mannosyl5-N-acetyl-glucosamine2-R

  • common name:
    • a (mannosyl)5-(N-acetylglucosaminyl)-N-glycan
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Mannosyl5-N-acetyl-glucosamine2-R&oldid=29490"