Difference between revisions of "RXN-12625"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] == * direction: ** LEFT-TO-RIGHT * common name: ** N,N'-diacetylchitobiose &be...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12625 RXN-12625] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** N,N'-diacetylchitobiose β-N-acetylglucosaminidase |
| − | * | + | ** Chitobiase/beta-hexosaminidase C-terminal domain |
| − | ** | + | * ec number: |
| + | ** [http://enzyme.expasy.org/EC/3.2.1.52 EC-3.2.1.52] | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CHITOBIOSE]][c] '''=>''' 2 [[N-acetyl-D-glucosamine]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 N,N'-diacetylchitobiose[c] '''=>''' 2 N-acetyl-D-glucosamine[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Ec-12_001990]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-6902]], chitin degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6902 PWY-6902] | ||
| + | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30674 30674] |
| − | * | + | * LIGAND-RXN: |
| − | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00022 R00022] |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=N,N'-diacetylchitobiose β-N-acetylglucosaminidase}} | |
| − | {{#set: | + | {{#set: common name=Chitobiase/beta-hexosaminidase C-terminal domain}} |
| − | {{#set: | + | {{#set: ec number=EC-3.2.1.52}} |
| − | {{#set: common name= | + | {{#set: gene associated=Ec-12_001990}} |
| − | {{#set: | + | {{#set: in pathway=PWY-6902}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Latest revision as of 19:48, 21 March 2018
Contents
Reaction RXN-12625
- direction:
- LEFT-TO-RIGHT
- common name:
- N,N'-diacetylchitobiose β-N-acetylglucosaminidase
- Chitobiase/beta-hexosaminidase C-terminal domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CHITOBIOSE[c] => 2 N-acetyl-D-glucosamine[c]
- With common name(s):
- 1 H2O[c] + 1 N,N'-diacetylchitobiose[c] => 2 N-acetyl-D-glucosamine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-12_001990
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
