Difference between revisions of "Ec-17 002880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...")
(Created page with "Category:Gene == Gene Ec-17_002880 == * Synonym(s): ** Esi_0026_0166 ** Esi0026_0166 == Reactions associated == * Reaction: RXN-711 ** Source: orthology-aragem ==...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] ==
+
== Gene Ec-17_002880 ==
−
* smiles:
+
−
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
+
−
* inchi key:
+
−
** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
+
−
* common name:
+
−
** 3'-ketolactose
+
−
* molecular weight:
+
−
** 340.283   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
+
** Esi_0026_0166
 +
** Esi0026_0166
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[KETOLACTOSE-RXN]]
+
* Reaction: [[RXN-711]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-2582]]
 +
* [[PWY-699]]
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: common name=Esi_0026_0166|Esi0026_0166}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571]
+
{{#set: reaction associated=RXN-711}}
−
* KEGG-GLYCAN : G10531
+
{{#set: pathway associated=PWY-2582|PWY-699}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057]
+
−
* HMDB : HMDB01030
+
−
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}}
+
−
{{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}}
+
−
{{#set: common name=3'-ketolactose}}
+
−
{{#set: molecular weight=340.283    }}
+
−
{{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}}
+
−
{{#set: consumed by=KETOLACTOSE-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-17_002880

  • Synonym(s):
    • Esi_0026_0166
    • Esi0026_0166

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-17_002880&oldid=29496"