Difference between revisions of "CPD-10329"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17786 RXN-17786] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17786 RXN-17786] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(OC(C(C(C1O)O)O)O)
 +
* inchi key:
 +
** InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N
 
* common name:
 
* common name:
−
** 6-phosphogluconate dehydrogenase, C-terminal-like
+
** α-L-fucopyranose
−
** 3-hydroxyacyl-CoA dehydrogenase
+
* molecular weight:
−
* ec number:
+
** 164.158   
−
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** α-L-fucose
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-19159]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-19160]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN0-5298]]
−
** 1 (S)-3-hydroxy-(11Z)-octadecenoyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 3-oxo-(11Z)-octadecenoyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-19_005290]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
* [[Ec-14_006530]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* DRUGBANK : DB04473
−
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
+
* PUBCHEM:
−
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439554 439554]
−
{{#set: ec number=EC-1.1.1.35}}
+
* HMDB : HMDB00174
−
{{#set: gene associated=Ec-19_005290|Ec-14_006530}}
+
* LIGAND-CPD:
−
{{#set: in pathway=}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://www.chemspider.com/Chemical-Structure.388645.html 388645]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42548 42548]
 +
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
 +
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N}}
 +
{{#set: common name=α-L-fucopyranose}}
 +
{{#set: molecular weight=164.158    }}
 +
{{#set: common name=α-L-fucose}}
 +
{{#set: reversible reaction associated=RXN0-5298}}

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-10329

  • smiles:
    • CC1(OC(C(C(C1O)O)O)O)
  • inchi key:
    • InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N
  • common name:
    • α-L-fucopyranose
  • molecular weight:
    • 164.158
  • Synonym(s):
    • α-L-fucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-10329&oldid=29498"