Difference between revisions of "3-KETOLACTOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETO-3-METHYL-VALERATE 2-KETO-3-METHYL-VALERATE] == * smiles: ** CCC(C)C(=O)C([O-])=O * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N |
* common name: | * common name: | ||
− | ** | + | ** 3'-ketolactose |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 340.283 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[KETOLACTOSE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571] |
− | * | + | * KEGG-GLYCAN : G10531 |
− | {{#set: smiles= | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403] |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057] |
− | {{#set: common name= | + | * HMDB : HMDB01030 |
− | {{#set: | + | {{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}} |
− | + | {{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}} | |
+ | {{#set: common name=3'-ketolactose}} | ||
+ | {{#set: molecular weight=340.283 }} | ||
+ | {{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}} | ||
+ | {{#set: consumed by=KETOLACTOSE-RXN}} |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite 3-KETOLACTOSE
- smiles:
- C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
- inchi key:
- InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
- common name:
- 3'-ketolactose
- molecular weight:
- 340.283
- Synonym(s):
- 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links