Difference between revisions of "Ec-21 003280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)...")
(Created page with "Category:Gene == Gene Ec-21_003280 == * left end position: ** 4244374 * transcription direction: ** NEGATIVE * right end position: ** 4248288 * centisome position: ** 57.5...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] ==
+
== Gene Ec-21_003280 ==
* smiles:
+
* left end position:
** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
+
** 4244374
* inchi key:
+
* transcription direction:
** InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
+
** NEGATIVE
* common name:
+
* right end position:
** lathosterol
+
** 4248288
* molecular weight:
+
* centisome position:
** 386.66    
+
** 57.510918    
 
* Synonym(s):
 
* Synonym(s):
** 5α-cholest-7-en-3β-ol
+
** Esi_0072_0034
** α-cholest-7-en-3β-ol
+
** Esi0072_0034
** cholesta-7-enol
+
** Δ7-cholesten-3-β-ol
+
** γ-cholesterol
+
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[1.14.21.6-RXN]]
+
* Reaction: [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[TRIGLSYN-PWY]]
 
== External links  ==
 
== External links  ==
* CAS : 80-99-9
+
{{#set: left end position=4244374}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65728 65728]
+
{{#set: right end position=4248288}}
* CHEBI:
+
{{#set: centisome position=57.510918   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17168 17168]
+
{{#set: common name=Esi_0072_0034|Esi0072_0034}}
* LIGAND-CPD:
+
{{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C01189 C01189]
+
{{#set: pathway associated=TRIGLSYN-PWY}}
* HMDB : HMDB01170
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N}}
+
{{#set: common name=lathosterol}}
+
{{#set: molecular weight=386.66   }}
+
{{#set: common name=5α-cholest-7-en-3β-ol|α-cholest-7-en-3β-ol|cholesta-7-enol|Δ7-cholesten-3-β-ol|γ-cholesterol}}
+
{{#set: consumed by=1.14.21.6-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-21_003280

  • left end position:
    • 4244374
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4248288
  • centisome position:
    • 57.510918
  • Synonym(s):
    • Esi_0072_0034
    • Esi0072_0034

Reactions associated

Pathways associated

External links