Difference between revisions of "6PFRUCTPHOS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PFRUCTPHOS-RXN 6PFRUCTPHOS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphofructo...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6PFRUCTPHOS-RXN 6PFRUCTPHOS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 6-phosphofructokinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.11 EC-2.7.1.11] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[FRUCTOSE-16-DIPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | = | + | * With common name(s): |
+ | ** 1 β-D-fructofuranose 6-phosphate[c] '''+''' 1 ATP[c] '''=>''' 1 fructose 1,6-bisphosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-14_003880]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | * Gene: [[Ec-22_000070]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-12_002540]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: GO-TERM | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] | ||
+ | ** '''8''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[GLYCOLYSIS]], glycolysis I (from glucose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=GLYCOLYSIS GLYCOLYSIS] | ||
+ | ** '''12''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[PWY-7385]], 1,3-propanediol biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7385 PWY-7385] | ||
+ | ** '''5''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-1861]], formaldehyde assimilation II (RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861] | ||
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[ANAGLYCOLYSIS-PWY]], glycolysis III (from glucose): [http://metacyc.org/META/NEW-IMAGE?object=ANAGLYCOLYSIS-PWY ANAGLYCOLYSIS-PWY] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-5484]], glycolysis II (from fructose 6-phosphate): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5484 PWY-5484] | ||
+ | ** '''11''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16109 16109] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00756 R00756] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q7M3F7 Q7M3F7] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M4J2 Q7M4J2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P12382 P12382] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q27665 Q27665] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P52034 P52034] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M4K9 Q7M4K9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43863 P43863] |
+ | ** [http://www.uniprot.org/uniprot/P20275 P20275] | ||
+ | ** [http://www.uniprot.org/uniprot/P47457 P47457] | ||
+ | ** [http://www.uniprot.org/uniprot/Q01813 Q01813] | ||
+ | ** [http://www.uniprot.org/uniprot/Q07636 Q07636] | ||
+ | ** [http://www.uniprot.org/uniprot/P16861 P16861] | ||
+ | ** [http://www.uniprot.org/uniprot/P16862 P16862] | ||
+ | ** [http://www.uniprot.org/uniprot/P00512 P00512] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A796 P0A796] | ||
+ | ** [http://www.uniprot.org/uniprot/P06999 P06999] | ||
+ | ** [http://www.uniprot.org/uniprot/P08237 P08237] | ||
+ | ** [http://www.uniprot.org/uniprot/P00511 P00511] | ||
+ | ** [http://www.uniprot.org/uniprot/P70927 P70927] | ||
+ | ** [http://www.uniprot.org/uniprot/Q7M3F5 Q7M3F5] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9TWY0 Q9TWY0] | ||
+ | ** [http://www.uniprot.org/uniprot/P30835 P30835] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03215 Q03215] | ||
+ | ** [http://www.uniprot.org/uniprot/Q03216 Q03216] | ||
+ | ** [http://www.uniprot.org/uniprot/P80019 P80019] | ||
+ | ** [http://www.uniprot.org/uniprot/Q59214 Q59214] | ||
+ | ** [http://www.uniprot.org/uniprot/Q27705 Q27705] | ||
+ | ** [http://www.uniprot.org/uniprot/P75476 P75476] | ||
+ | ** [http://www.uniprot.org/uniprot/P72830 P72830] | ||
+ | ** [http://www.uniprot.org/uniprot/Q55988 Q55988] | ||
+ | ** [http://www.uniprot.org/uniprot/Q49084 Q49084] | ||
+ | ** [http://www.uniprot.org/uniprot/O08333 O08333] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=6-phosphofructokinase}} | ||
+ | {{#set: ec number=EC-2.7.1.11}} | ||
+ | {{#set: gene associated=Ec-14_003880|Ec-22_000070|Ec-12_002540}} | ||
+ | {{#set: in pathway=PWY-1042|GLYCOLYSIS|PWY-7385|PWY-1861|ANAGLYCOLYSIS-PWY|PWY-5484}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:49, 21 March 2018
Contents
Reaction 6PFRUCTPHOS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 6-phosphofructokinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 FRUCTOSE-6P[c] + 1 ATP[c] => 1 FRUCTOSE-16-DIPHOSPHATE[c] + 1 PROTON[c] + 1 ADP[c]
- With common name(s):
- 1 β-D-fructofuranose 6-phosphate[c] + 1 ATP[c] => 1 fructose 1,6-bisphosphate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-14_003880
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: annotation-esiliculosus_genome
- Gene: Ec-22_000070
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-12_002540
- Source: annotation-esiliculosus_genome
- Assignment: GO-TERM
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- PWY-1042, glycolysis IV (plant cytosol): PWY-1042
- 8 reactions found over 10 reactions in the full pathway
- GLYCOLYSIS, glycolysis I (from glucose 6-phosphate): GLYCOLYSIS
- 12 reactions found over 12 reactions in the full pathway
- PWY-7385, 1,3-propanediol biosynthesis (engineered): PWY-7385
- 5 reactions found over 9 reactions in the full pathway
- PWY-1861, formaldehyde assimilation II (RuMP Cycle): PWY-1861
- 7 reactions found over 9 reactions in the full pathway
- ANAGLYCOLYSIS-PWY, glycolysis III (from glucose): ANAGLYCOLYSIS-PWY
- 10 reactions found over 10 reactions in the full pathway
- PWY-5484, glycolysis II (from fructose 6-phosphate): PWY-5484
- 11 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: