Difference between revisions of "PWY-5871"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * inch...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5871 PWY-5871] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** ubiquinol-9 biosynthesis (eukaryotic) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Q9 biosynthesis | ||
| + | ** ubiquinone-9 biosynthesis (eukaryotic) | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''8''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[2.5.1.39-RXN]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Ec-00_007360]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.1.1.64-RXN 2.1.1.64-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9241 RXN-9241] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9242 RXN-9242] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9243 RXN-9243] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9278 RXN-9278] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9281 RXN-9281] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9284 RXN-9284] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=ubiquinol-9 biosynthesis (eukaryotic)}} | |
| − | + | {{#set: common name=Q9 biosynthesis|ubiquinone-9 biosynthesis (eukaryotic)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=8}} | |
| − | + | {{#set: completion rate=13.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:10, 21 March 2018
Pathway PWY-5871
- taxonomic range:
- common name:
- ubiquinol-9 biosynthesis (eukaryotic)
- Synonym(s):
- Q9 biosynthesis
- ubiquinone-9 biosynthesis (eukaryotic)
Reaction(s) found
1 reactions found over 8 reactions in the full pathway
- 2.5.1.39-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
