Difference between revisions of "ENOYL-COA-DELTA-ISOM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-COA-DELTA-ISOM-RXN ENOYL-COA-DELTA-ISOM-RXN] == * direction: ** REVERSIBLE * common name: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ENOYL-COA-DELTA-ISOM-RXN ENOYL-COA-DELTA-ISOM-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Enoyl-CoA hydratase/isomerase family protein |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.3.3.8 EC-5.3.3.8] |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** probable enoyl-CoA hydratase/isomerase |
+ | ** probable enoyl CoA-hydratase/isomerase | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[CIS-DELTA3-ENOYL-COA]][c] '''<=>''' 1 [[TRANS-D2-ENOYL-COA]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 a cis-3-enoyl-CoA[c] '''<=>''' 1 a trans-2-enoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-20_003150]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5137]], fatty acid β-oxidation III (unsaturated, odd number): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5137 PWY-5137] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | * [[FAO-PWY]], fatty acid β-oxidation I: [http://metacyc.org/META/NEW-IMAGE?object=FAO-PWY FAO-PWY] | ||
+ | ** '''5''' reactions found over '''7''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P21177 P21177] |
− | * | + | ** [http://www.uniprot.org/uniprot/P42126 P42126] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P07896 P07896] |
− | * | + | ** [http://www.uniprot.org/uniprot/P23965 P23965] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q64592 Q64592] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M0E0 Q7M0E0] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P42125 P42125] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q39659 Q39659] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=Enoyl-CoA hydratase/isomerase family protein}} |
+ | {{#set: ec number=EC-5.3.3.8}} | ||
+ | {{#set: common name=probable enoyl-CoA hydratase/isomerase|probable enoyl CoA-hydratase/isomerase}} | ||
+ | {{#set: gene associated=Ec-20_003150}} | ||
+ | {{#set: in pathway=PWY-5137|FAO-PWY}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:49, 21 March 2018
Contents
Reaction ENOYL-COA-DELTA-ISOM-RXN
- direction:
- REVERSIBLE
- common name:
- Enoyl-CoA hydratase/isomerase family protein
- ec number:
- Synonym(s):
- probable enoyl-CoA hydratase/isomerase
- probable enoyl CoA-hydratase/isomerase
Reaction Formula
- With identifiers:
- 1 CIS-DELTA3-ENOYL-COA[c] <=> 1 TRANS-D2-ENOYL-COA[c]
- With common name(s):
- 1 a cis-3-enoyl-CoA[c] <=> 1 a trans-2-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-20_003150
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
- PWY-5137, fatty acid β-oxidation III (unsaturated, odd number): PWY-5137
- 1 reactions found over 1 reactions in the full pathway
- FAO-PWY, fatty acid β-oxidation I: FAO-PWY
- 5 reactions found over 7 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links