Difference between revisions of "CPD-725"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R344-RXN R344-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** cob(I)yrinic acid a,c-diamide...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R344-RXN R344-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
 +
* inchi key:
 +
** InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
 
* common name:
 
* common name:
−
** cob(I)yrinic acid a,c-diamide adenosyltransferase
+
** 13(S)-HPOTE
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.5.1.17 EC-2.5.1.17]
+
** 309.425   
 
* Synonym(s):
 
* Synonym(s):
 +
** 13(S)-hydroperoxylinolenic acid
 +
** hydroperoxylinolenic acid
 +
** 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
 +
** 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
 +
** 13(S)-hydroperoxylinolenate
 +
** (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[CPD-694]][c] '''=>''' 1 [[CPD-690]][c] '''+''' 1 [[P3I]][c]
+
* [[RXN-1321]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 cob(I)yrinate a,c-diamide[c] '''=>''' 1 adenosyl-cobyrinate a,c-diamide[c] '''+''' 1 PPPi[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-06_010830]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-5509]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5509 PWY-5509]
+
−
** '''1''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-5508]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508]
+
−
** '''1''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11528 11528]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266757 45266757]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R05220 R05220]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58757 58757]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=cob(I)yrinic acid a,c-diamide adenosyltransferase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04785 C04785]
−
{{#set: ec number=EC-2.5.1.17}}
+
{{#set: smiles=CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO}}
−
{{#set: gene associated=Ec-06_010830}}
+
{{#set: inchi key=InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M}}
−
{{#set: in pathway=PWY-5509|PWY-5508}}
+
{{#set: common name=13(S)-HPOTE}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=309.425    }}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: common name=13(S)-hydroperoxylinolenic acid|hydroperoxylinolenic acid|13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid|13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate|13(S)-hydroperoxylinolenate|(9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-1321}}

Latest revision as of 19:49, 21 March 2018

Metabolite CPD-725

  • smiles:
    • CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
  • inchi key:
    • InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
  • common name:
    • 13(S)-HPOTE
  • molecular weight:
    • 309.425
  • Synonym(s):
    • 13(S)-hydroperoxylinolenic acid
    • hydroperoxylinolenic acid
    • 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
    • 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
    • 13(S)-hydroperoxylinolenate
    • (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-725&oldid=29590"