Difference between revisions of "7Z-3-oxo-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
−
* smiles:
+
−
** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))
+
−
* inchi key:
+
−
** InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M
+
 
* common name:
 
* common name:
−
** biotin
+
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
−
* molecular weight:
+
−
** 243.3  
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin H
 
−
** coenzyme R
 
−
** d-biotin
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[6.3.4.10-RXN]]
+
* [[RXN-16622]]
−
* [[6.3.4.9-RXN]]
+
−
* [[BIOTINLIG-RXN]]
+
−
* [[6.3.4.11-RXN]]
+
−
* [[TransportSeed_BIOTIN]]
+
−
* [[RXN0-7192]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[2.8.1.6-RXN]]
+
* [[RXN-16621]]
−
* [[TransportSeed_BIOTIN]]
+
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[ExchangeSeed_BIOTIN]]
 
−
* [[RXN-17473]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 58-85-5
+
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
−
* BIGG : 33931
+
{{#set: consumed by=RXN-16622}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-16621}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560210 6560210]
+
−
* HMDB : HMDB00030
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00120 C00120]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5028036.html 5028036]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57586 57586]
+
−
* METABOLIGHTS : MTBLC57586
+
−
{{#set: smiles=C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12))}}
+
−
{{#set: inchi key=InChIKey=YBJHBAHKTGYVGT-ZKWXMUAHSA-M}}
+
−
{{#set: common name=biotin}}
+
−
{{#set: molecular weight=243.3    }}
+
−
{{#set: common name=vitamin H|coenzyme R|d-biotin}}
+
−
{{#set: consumed by=6.3.4.10-RXN|6.3.4.9-RXN|BIOTINLIG-RXN|6.3.4.11-RXN|TransportSeed_BIOTIN|RXN0-7192}}
+
−
{{#set: produced by=2.8.1.6-RXN|TransportSeed_BIOTIN}}
+
−
{{#set: reversible reaction associated=ExchangeSeed_BIOTIN|RXN-17473}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs

  • common name:
    • a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (7Z)-3-oxo-hexadec-7-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=7Z-3-oxo-hexadec-7-enoyl-ACPs&oldid=29594"