Difference between revisions of "Ec-06 000810"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Gene == Gene Ec-06_000810 == * left end position: ** 537172 * transcription direction: ** POSITIVE * right end position: ** 546438 * centisome position: ** 6.1336...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_000810 == |
− | * | + | * left end position: |
− | ** | + | ** 537172 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 546438 |
− | * | + | * centisome position: |
− | ** | + | ** 6.1336703 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0085_0008 |
− | ** | + | ** Esi0085_0008 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: go-term | |
− | * [[ | + | == Pathways associated == |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=537172}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=546438}} | |
− | + | {{#set: centisome position=6.1336703 }} | |
− | + | {{#set: common name=Esi_0085_0008|Esi0085_0008}} | |
− | + | {{#set: reaction associated=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:49, 21 March 2018
Gene Ec-06_000810
- left end position:
- 537172
- transcription direction:
- POSITIVE
- right end position:
- 546438
- centisome position:
- 6.1336703
- Synonym(s):
- Esi_0085_0008
- Esi0085_0008
Reactions associated
- Reaction: TRNA-URACIL-5--METHYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome