Difference between revisions of "Ec-19 005250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...")
(Created page with "Category:Gene == Gene Ec-19_005250 == * left end position: ** 5621607 * transcription direction: ** NEGATIVE * right end position: ** 5641274 * centisome position: ** 94.1...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] ==
+
== Gene Ec-19_005250 ==
−
* smiles:
+
* left end position:
−
** C(O)C(=O)C(O)C(O)C(O)CO
+
** 5621607
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** keto-L-sorbose
+
** 5641274
−
* molecular weight:
+
* centisome position:
−
** 180.157    
+
** 94.15342    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0154_0054
 +
** Esi0154_0054
 +
** TPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN1G-1435]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-14811]]
+
*** Assignment: automated-name-match
−
* [[L-IDITOL-2-DEHYDROGENASE-RXN]]
+
* Reaction: [[RXN1G-1436]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN1G-1437]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN1G-1438]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN1G-1439]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[TREHALOSE6PSYN-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TREHALOSEPHOSPHA-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWYG-321]]
 +
* [[TREHALOSESYN-PWY]]
 +
* [[TRESYN-PWY]]
 +
* [[PWY-881]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5621607}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=5641274}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172]
+
{{#set: centisome position=94.15342    }}
−
* METABOLIGHTS : MTBLC13172
+
{{#set: common name=Esi_0154_0054|Esi0154_0054|TPS}}
−
{{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}}
+
{{#set: reaction associated=RXN1G-1435|RXN1G-1436|RXN1G-1437|RXN1G-1438|RXN1G-1439|TREHALOSE6PSYN-RXN|TREHALOSEPHOSPHA-RXN}}
−
{{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}}
+
{{#set: pathway associated=PWYG-321|TREHALOSESYN-PWY|TRESYN-PWY|PWY-881}}
−
{{#set: common name=keto-L-sorbose}}
+
−
{{#set: molecular weight=180.157    }}
+
−
{{#set: reversible reaction associated=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-19_005250

  • left end position:
    • 5621607
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5641274
  • centisome position:
    • 94.15342
  • Synonym(s):
    • Esi_0154_0054
    • Esi0154_0054
    • TPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_005250&oldid=29618"