Difference between revisions of "PWY-5168"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ferulate and sinapate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''4''' reactions in the full pathway |
− | * [[ | + | * [[RXN-1143]] |
− | + | ** 1 associated gene(s): | |
− | == Reaction(s) | + | *** [[Ec-01_004720]] |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1142 RXN-1142] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1241 RXN-1241] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8014 RXN-8014] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5168 PWY-5168] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-58024}} |
− | + | {{#set: common name=ferulate and sinapate biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:10, 21 March 2018
Pathway PWY-5168
- taxonomic range:
- common name:
- ferulate and sinapate biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-1143
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: