Difference between revisions of "CPD-15616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-glutamyl-tRNAGln L-glutamyl-tRNAGln] == * common name: ** an L-glutamyl-[tRNAGln] * Synonym(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15616 CPD-15616] == |
+ | * smiles: | ||
+ | ** C(O)C(=O)C(O)C(O)C(O)CO | ||
+ | * inchi key: | ||
+ | ** InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N | ||
* common name: | * common name: | ||
− | ** | + | ** keto-L-sorbose |
+ | * molecular weight: | ||
+ | ** 180.157 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14811]] | ||
+ | * [[L-IDITOL-2-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6904 6904] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13172 13172] |
+ | * METABOLIGHTS : MTBLC13172 | ||
+ | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | ||
+ | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N}} | ||
+ | {{#set: common name=keto-L-sorbose}} | ||
+ | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: reversible reaction associated=RXN-14811|L-IDITOL-2-DEHYDROGENASE-RXN}} |
Latest revision as of 20:50, 21 March 2018
Contents
Metabolite CPD-15616
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-OTWZMJIISA-N
- common name:
- keto-L-sorbose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links