Difference between revisions of "CD-2S-SP-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-2S-SP-Complex CD-2S-SP-Complex] == * common name: ** a [cysteine desulfurase]-(S-sulfanyl)2-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-D-LACTONE GLC-D-LACTONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CD-2S-SP-Complex CD-2S-SP-Complex] ==
−
* smiles:
+
−
** C(O)C1(OC(C(C(C1O)O)O)=O)
+
−
* inchi key:
+
−
** InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N
+
 
* common name:
 
* common name:
−
** D-glucono-1,5-lactone
+
** a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex
−
* molecular weight:
+
−
** 178.141   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one
 
−
** gluconolactone
 
−
** glucono-1,5-lactone
 
−
** 1,5-gluconolactone
 
−
** D-gluconolactone
 
−
** glucono-δ-lactone
 
−
** δ-gluconolactone
 
−
** D-glucono-δ-lactone
 
−
** gluconic lactone
 
−
** gluconic acid lactone
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[GLUCONOLACT-RXN]]
+
* [[RXN-14387]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14386]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RXN-11334]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 90-80-2
+
{{#set: common name=a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex}}
−
* DRUGBANK : DB04564
+
{{#set: consumed by=RXN-14387}}
−
* PUBCHEM:
+
{{#set: produced by=RXN-14386}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7027 7027]
+
−
* HMDB : HMDB00150
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00198 C00198]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.6760.html 6760]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16217 16217]
+
−
{{#set: smiles=C(O)C1(OC(C(C(C1O)O)O)=O)}}
+
−
{{#set: inchi key=InChIKey=PHOQVHQSTUBQQK-SQOUGZDYSA-N}}
+
−
{{#set: common name=D-glucono-1,5-lactone}}
+
−
{{#set: molecular weight=178.141    }}
+
−
{{#set: common name=3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydropyran-2-one|gluconolactone|glucono-1,5-lactone|1,5-gluconolactone|D-gluconolactone|glucono-δ-lactone|δ-gluconolactone|D-glucono-δ-lactone|gluconic lactone|gluconic acid lactone}}
+
−
{{#set: consumed by=GLUCONOLACT-RXN}}
+
−
{{#set: reversible reaction associated=RXN-11334}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite CD-2S-SP-Complex

  • common name:
    • a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [cysteine desulfurase]-(S-sulfanyl)2-[disordered-form scaffold protein] complex" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CD-2S-SP-Complex&oldid=29648"