Difference between revisions of "Ec-13 000360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
(Created page with "Category:Gene == Gene Ec-13_000360 == * left end position: ** 1156771 * transcription direction: ** POSITIVE * right end position: ** 1166734 * centisome position: ** 16.6...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
+
== Gene Ec-13_000360 ==
−
* smiles:
+
* left end position:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** 1156771
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** gibberellin A24
+
** 1166734
−
* molecular weight:
+
* centisome position:
−
** 344.407    
+
** 16.677141    
 
* Synonym(s):
 
* Synonym(s):
−
** GA24
+
** Esi_0191_0048
 +
** Esi0191_0048
 +
** CDKI1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN1F-163]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1156771}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1166734}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
+
{{#set: centisome position=16.677141   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0191_0048|Esi0191_0048|CDKI1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* HMDB : HMDB37103
+
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
+
−
{{#set: common name=gibberellin A24}}
+
−
{{#set: molecular weight=344.407   }}
+
−
{{#set: common name=GA24}}
+
−
{{#set: produced by=RXN1F-163}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-13_000360

  • left end position:
    • 1156771
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1166734
  • centisome position:
    • 16.677141
  • Synonym(s):
    • Esi_0191_0048
    • Esi0191_0048
    • CDKI1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-13_000360&oldid=29651"