Difference between revisions of "Ec-04 004960"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * inchi key...") |
(Created page with "Category:Gene == Gene Ec-04_004960 == * left end position: ** 5047328 * transcription direction: ** NEGATIVE * right end position: ** 5054883 * centisome position: ** 77.5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_004960 == |
− | * | + | * left end position: |
− | ** | + | ** 5047328 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5054883 |
− | * | + | * centisome position: |
− | ** | + | ** 77.50988 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0037_0100 |
− | ** | + | ** Esi0037_0100 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | + | == Pathways associated == | |
+ | * [[PWY-4041]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5047328}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5054883}} | |
− | + | {{#set: centisome position=77.50988 }} | |
− | + | {{#set: common name=Esi_0037_0100|Esi0037_0100}} | |
− | + | {{#set: reaction associated=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-4041}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Gene Ec-04_004960
- left end position:
- 5047328
- transcription direction:
- NEGATIVE
- right end position:
- 5054883
- centisome position:
- 77.50988
- Synonym(s):
- Esi_0037_0100
- Esi0037_0100
Reactions associated
- Reaction: GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome