Difference between revisions of "NN-DIMETHYLANILINE-N-OXIDE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_005870 == * left end position: ** 5431780 * transcription direction: ** NEGATIVE * right end position: ** 5447107 * centisome position: ** 82.7...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE-N-OXIDE NN-DIMETHYLANILINE-N-OXIDE] == * smiles: ** CN(C)(=O)C1(C=CC=CC=1) *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NN-DIMETHYLANILINE-N-OXIDE NN-DIMETHYLANILINE-N-OXIDE] == |
− | * | + | * smiles: |
− | ** | + | ** CN(C)(=O)C1(C=CC=CC=1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N |
− | * | + | * common name: |
− | ** | + | ** N,N-dimethylaniline-N-oxide |
− | * | + | * molecular weight: |
− | ** | + | ** 137.181 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[1.14.13.8-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=950 950] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.925.html 925] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17735 17735] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01183 C01183] | ||
+ | * HMDB : HMDB01466 | ||
+ | {{#set: smiles=CN(C)(=O)C1(C=CC=CC=1)}} | ||
+ | {{#set: inchi key=InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=N,N-dimethylaniline-N-oxide}} | ||
+ | {{#set: molecular weight=137.181 }} | ||
+ | {{#set: produced by=1.14.13.8-RXN}} |
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite NN-DIMETHYLANILINE-N-OXIDE
- smiles:
- CN(C)(=O)C1(C=CC=CC=1)
- inchi key:
- InChIKey=LKQUDAOAMBKKQW-UHFFFAOYSA-N
- common name:
- N,N-dimethylaniline-N-oxide
- molecular weight:
- 137.181
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links