Difference between revisions of "ExchangeSeed COB-I-ALAMIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_COB-I-ALAMIN ExchangeSeed_COB-I-ALAMIN] == * direction: ** REVERSIBLE * Synonym(s): =...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_COB-I-ALAMIN ExchangeSeed_COB-I-ALAMIN] ==
−
* smiles:
+
* direction:
−
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
+
−
* common name:
+
−
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
+
−
* molecular weight:
+
−
** 572.278   
+
 
* Synonym(s):
 
* Synonym(s):
−
** iPTP
 
−
** isopentenyladenosine riboside-5'-triphosphate
 
−
** iPRTP
 
−
** isopentenyladenosine-5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-4303]]
+
** 1.0 [[COB-I-ALAMIN]][C-BOUNDARY] '''<=>''' 1.0 [[COB-I-ALAMIN]][e]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 cob(I)alamin[C-BOUNDARY] '''<=>''' 1.0 cob(I)alamin[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=manual}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
+
{{#set: reconstruction source=manual-import_from_medium}}
−
* LIGAND-CPD:
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
+
−
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
+
−
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
+
−
{{#set: common name=N6-(&Delta;2-isopentenyl)-adenosine 5'-triphosphate}}
+
−
{{#set: molecular weight=572.278    }}
+
−
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
+
−
{{#set: produced by=RXN-4303}}
+

Latest revision as of 20:50, 21 March 2018

Reaction ExchangeSeed_COB-I-ALAMIN

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 cob(I)alamin[C-BOUNDARY] <=> 1.0 cob(I)alamin[e]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ExchangeSeed_COB-I-ALAMIN&oldid=29669"