Difference between revisions of "Jasmonic-Acids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] == * smiles: ** C([O-])(=O)C=CC([O-])=O * inchi key: ** InChIKey=VZCYOOQTPOCHF...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Jasmonic-Acids Jasmonic-Acids] == * common name: ** a jasmonic acid * Synonym(s): ** a jasmonat...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEATE MALEATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Jasmonic-Acids Jasmonic-Acids] ==
* smiles:
+
** C([O-])(=O)C=CC([O-])=O
+
* inchi key:
+
** InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L
+
 
* common name:
 
* common name:
** maleate
+
** a jasmonic acid
* molecular weight:
+
** 114.057   
+
 
* Synonym(s):
 
* Synonym(s):
** maleic acid
+
** a jasmonate
** cis-butenedioic acid
+
** a JA
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-646]]
+
* [[RXN-10767]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 110-16-7
+
{{#set: common name=a jasmonic acid}}
* PUBCHEM:
+
{{#set: common name=a jasmonate|a JA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5288227 5288227]
+
{{#set: produced by=RXN-10767}}
* HMDB : HMDB00176
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01384 C01384]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.4450430.html 4450430]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30780 30780]
+
{{#set: smiles=C([O-])(=O)C=CC([O-])=O}}
+
{{#set: inchi key=InChIKey=VZCYOOQTPOCHFL-UPHRSURJSA-L}}
+
{{#set: common name=maleate}}
+
{{#set: molecular weight=114.057    }}
+
{{#set: common name=maleic acid|cis-butenedioic acid}}
+
{{#set: produced by=RXN-646}}
+

Latest revision as of 19:50, 21 March 2018

Metabolite Jasmonic-Acids

  • common name:
    • a jasmonic acid
  • Synonym(s):
    • a jasmonate
    • a JA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links