Difference between revisions of "Ec-18 003420"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C))...")
(Created page with "Category:Gene == Gene Ec-18_003420 == * left end position: ** 3416508 * transcription direction: ** POSITIVE * right end position: ** 3426404 * centisome position: ** 69.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-134 CPD1F-134] ==
+
== Gene Ec-18_003420 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 3416508
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** gibberellin A9
+
** 3426404
−
* molecular weight:
+
* centisome position:
−
** 315.388    
+
** 69.34880    
 
* Synonym(s):
 
* Synonym(s):
−
** C19-GAs
+
** Esi_0022_0141
−
** closed lactone gibberellin skeleton
+
** Esi0022_0141
−
** C19 skeleton
+
** PDH
−
** C19-GA skeleton
+
−
** C19-gibberellin skeleton
+
−
** GA9
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN1F-165]]
+
* Reaction: [[PYFLAVOXRE-RXN]]
−
* [[RXN-171]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PYRUFLAVREDUCT-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[PYRUVDEH-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-12508]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12583]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN0-1134]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7384]]
 +
* [[P23-PWY]]
 +
* [[PWY-5493]]
 +
* [[PWY-6587]]
 +
* [[PWY-5497]]
 +
* [[PWY-6588]]
 +
* [[P42-PWY]]
 +
* [[P142-PWY]]
 +
* [[PWY-6886]]
 +
* [[PWY-6876]]
 +
* [[NPGLUCAT-PWY]]
 +
* [[CENTFERM-PWY]]
 +
* [[PYRUVDEHYD-PWY]]
 +
* [[PWY-5600]]
 +
* [[PWY-6142]]
 +
* [[PWY-5482]]
 +
* [[PWY-5483]]
 +
* [[PWY-6583]]
 +
* [[PWY-7218]]
 +
* [[PWY-5392]]
 +
* [[PWY-5537]]
 +
* [[GLUDEG-II-PWY]]
 +
* [[PWY-6863]]
 +
* [[PWY-5538]]
 +
* [[GLYCOLYSIS-TCA-GLYOX-BYPASS]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3416508}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244370 25244370]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=3426404}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73255 73255]
+
{{#set: centisome position=69.34880   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0022_0141|Esi0022_0141|PDH}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11863 C11863]
+
{{#set: reaction associated=PYFLAVOXRE-RXN|PYRUFLAVREDUCT-RXN|PYRUVDEH-RXN|RXN-12508|RXN-12583|RXN0-1134}}
−
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: pathway associated=PWY-7384|P23-PWY|PWY-5493|PWY-6587|PWY-5497|PWY-6588|P42-PWY|P142-PWY|PWY-6886|PWY-6876|NPGLUCAT-PWY|CENTFERM-PWY|PYRUVDEHYD-PWY|PWY-5600|PWY-6142|PWY-5482|PWY-5483|PWY-6583|PWY-7218|PWY-5392|PWY-5537|GLUDEG-II-PWY|PWY-6863|PWY-5538|GLYCOLYSIS-TCA-GLYOX-BYPASS}}
−
{{#set: inchi key=InChIKey=MHVYWTXXZIFXDT-PKZSZHAESA-M}}
+
−
{{#set: common name=gibberellin A9}}
+
−
{{#set: molecular weight=315.388   }}
+
−
{{#set: common name=C19-GAs|closed lactone gibberellin skeleton|C19 skeleton|C19-GA skeleton|C19-gibberellin skeleton|GA9}}
+
−
{{#set: consumed by=RXN1F-165|RXN-171}}
+

Latest revision as of 20:50, 21 March 2018

Gene Ec-18_003420

  • left end position:
    • 3416508
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3426404
  • centisome position:
    • 69.34880
  • Synonym(s):
    • Esi_0022_0141
    • Esi0022_0141
    • PDH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_003420&oldid=29691"