Difference between revisions of "CPD0-2123"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_000700 == * left end position: ** 665802 * transcription direction: ** POSITIVE * right end position: ** 669674 * centisome position: ** 12.912...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * smiles: ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J |
| − | * | + | * common name: |
| − | ** | + | ** 3-oxodecanoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 931.738 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13617]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-12490]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * BIGG : 45458 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53262297 53262297] |
| − | {{#set: | + | * HMDB : HMDB03939 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05265 C05265] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62548 62548] | ||
| + | * METABOLIGHTS : MTBLC28528 | ||
| + | {{#set: smiles=CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| + | {{#set: inchi key=InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J}} | ||
| + | {{#set: common name=3-oxodecanoyl-CoA}} | ||
| + | {{#set: molecular weight=931.738 }} | ||
| + | {{#set: consumed by=RXN-13617}} | ||
| + | {{#set: produced by=RXN-12490}} | ||
Latest revision as of 19:50, 21 March 2018
Contents
Metabolite CPD0-2123
- smiles:
- CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=AZCVXMAPLHSIKY-HSJNEKGZSA-J
- common name:
- 3-oxodecanoyl-CoA
- molecular weight:
- 931.738
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 45458
- PUBCHEM:
- HMDB : HMDB03939
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC28528
"CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
