Difference between revisions of "Ec-01 000060"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * smiles: ** CC(=O)NC2(C(O)OC(CO)C(O)C(OC1(OC(C([O-])=O)=CC(O)C(O)1))2) * inc...") |
(Created page with "Category:Gene == Gene Ec-01_000060 == * left end position: ** 22384 * transcription direction: ** NEGATIVE * right end position: ** 25073 * centisome position: ** 0.216923...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_000060 == |
− | * | + | * left end position: |
− | ** | + | ** 22384 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 25073 |
− | * | + | * centisome position: |
− | ** | + | ** 0.21692373 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0207_0005 |
− | ** | + | ** Esi0207_0005 |
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[DIAMINOPIMDECARB-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-5097]] | ||
+ | * [[PWY-2942]] | ||
+ | * [[DAPLYSINESYN-PWY]] | ||
+ | * [[PWY-2941]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=22384}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=25073}} | |
− | + | {{#set: centisome position=0.21692373 }} | |
− | + | {{#set: common name=Esi_0207_0005|Esi0207_0005}} | |
− | + | {{#set: reaction associated=DIAMINOPIMDECARB-RXN}} | |
− | {{#set: | + | {{#set: pathway associated=PWY-5097|PWY-2942|DAPLYSINESYN-PWY|PWY-2941}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Gene Ec-01_000060
- left end position:
- 22384
- transcription direction:
- NEGATIVE
- right end position:
- 25073
- centisome position:
- 0.21692373
- Synonym(s):
- Esi_0207_0005
- Esi0207_0005
Reactions associated
- Reaction: DIAMINOPIMDECARB-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome