Difference between revisions of "Ec-18 003900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Gene == Gene Ec-18_003900 == * left end position: ** 3805141 * transcription direction: ** NEGATIVE * right end position: ** 3810549 * centisome position: ** 77.2...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Gene Ec-18_003900 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3805141
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 6-cis-tridecenoyl-CoA
+
** 3810549
−
* molecular weight:
+
* centisome position:
−
** 957.819    
+
** 77.23733    
 
* Synonym(s):
 
* Synonym(s):
−
** 6Z-tridecenoyl-CoA
+
** Esi_0022_0078
 +
** Esi0022_0078
 +
** NUO10
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-14771]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5330]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-7269]]
 +
* [[PWY-7279]]
 +
* [[PWY0-1567]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1335]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1568]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3805141}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=3810549}}
−
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: centisome position=77.23733   }}
−
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: common name=Esi_0022_0078|Esi0022_0078|NUO10}}
−
{{#set: molecular weight=957.819   }}
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|RXN0-5330}}
−
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-7269|PWY-7279|PWY0-1567|PWY-5083|PWY0-1335|PWY0-1334|PWY0-1568|PWY-4302}}
−
{{#set: consumed by=RXN-14771}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-18_003900

  • left end position:
    • 3805141
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3810549
  • centisome position:
    • 77.23733
  • Synonym(s):
    • Esi_0022_0078
    • Esi0022_0078
    • NUO10

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_003900&oldid=29725"