Difference between revisions of "CPD-397"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * smiles: ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * inchi key: ** InChIKey=YDBYJHTYSH...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C[S+](CCC([N+])C(=O)[O-])C |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O |
* common name: | * common name: | ||
− | ** | + | ** S-methyl-L-methionine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 164.242 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** S-methylmethionine |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[MMUM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252] |
− | * | + | * BIGG : 41336 |
− | {{#set: smiles=C | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172] |
− | {{#set: common name= | + | {{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}} |
− | {{#set: common name= | + | {{#set: common name=S-methyl-L-methionine}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=164.242 }} |
− | + | {{#set: common name=S-methylmethionine}} | |
+ | {{#set: consumed by=MMUM-RXN}} |
Latest revision as of 20:51, 21 March 2018
Contents
Metabolite CPD-397
- smiles:
- C[S+](CCC([N+])C(=O)[O-])C
- inchi key:
- InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
- common name:
- S-methyl-L-methionine
- molecular weight:
- 164.242
- Synonym(s):
- S-methylmethionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.