Difference between revisions of "Ec-01 005280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
(Created page with "Category:Gene == Gene Ec-01_005280 == * left end position: ** 4547325 * transcription direction: ** POSITIVE * right end position: ** 4554856 * centisome position: ** 44.0...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_005280 == |
− | * | + | * left end position: |
− | ** | + | ** 4547325 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4554856 |
− | * | + | * centisome position: |
− | ** | + | ** 44.068207 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0018_0069 | ||
+ | ** Esi0018_0069 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[3.4.23.1-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[RXN- | + | *** Assignment: go-term |
− | == | + | * Reaction: [[RXN-8443]] |
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4547325}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4554856}} | |
− | + | {{#set: centisome position=44.068207 }} | |
− | + | {{#set: common name=Esi_0018_0069|Esi0018_0069}} | |
− | + | {{#set: reaction associated=3.4.23.1-RXN|RXN-8443}} | |
− | + | {{#set: pathway associated=PWY-5381}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:51, 21 March 2018
Gene Ec-01_005280
- left end position:
- 4547325
- transcription direction:
- POSITIVE
- right end position:
- 4554856
- centisome position:
- 44.068207
- Synonym(s):
- Esi_0018_0069
- Esi0018_0069
Reactions associated
- Reaction: 3.4.23.1-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome
- Reaction: RXN-8443
- Source: orthology-aragem