Difference between revisions of "DMPBQ"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLUTATHIONE-REDUCT-NADPH-RXN GLUTATHIONE-REDUCT-NADPH-RXN] == * direction: ** LEFT-TO-RIGHT * commo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DMPBQ DMPBQ] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C |
+ | * inchi key: | ||
+ | ** InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 2,3-dimethyl-6-phytyl-1,4-benzoquinol |
− | + | * molecular weight: | |
− | * | + | ** 416.686 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-2543]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-2542]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71768102 71768102] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75921 75921] |
− | + | * METABOLIGHTS : MTBLC75921 | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15883 C15883] | |
− | * | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C}} |
− | * | + | {{#set: inchi key=InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N}} |
− | ** [http://www. | + | {{#set: common name=2,3-dimethyl-6-phytyl-1,4-benzoquinol}} |
− | + | {{#set: molecular weight=416.686 }} | |
− | + | {{#set: consumed by=RXN-2543}} | |
− | + | {{#set: produced by=RXN-2542}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite DMPBQ
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCC1(C=C(C(C)=C(C)C=1O)O))C)C
- inchi key:
- InChIKey=SUFZKUBNOVDJRR-WGEODTKDSA-N
- common name:
- 2,3-dimethyl-6-phytyl-1,4-benzoquinol
- molecular weight:
- 416.686
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links