Difference between revisions of "CPD-18494"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18494 CPD-18494] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1118.034 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17116]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17115]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
| − | + | {{#set: inchi key=InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J}} | |
| − | + | {{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA}} | |
| − | + | {{#set: molecular weight=1118.034 }} | |
| − | + | {{#set: common name=3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA}} | |
| − | + | {{#set: consumed by=RXN-17116}} | |
| − | + | {{#set: produced by=RXN-17115}} | |
| − | + | ||
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
| − | {{#set: | + | |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite CPD-18494
- smiles:
- CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=UIAGUJIMVQPSDP-QOJZHLSOSA-J
- common name:
- 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA
- molecular weight:
- 1118.034
- Synonym(s):
- 3-oxo-(6Z,9Z,12Z,15Z,18Z)-tetracosa-6,9,12,15,18-pentaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCC=CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
