Difference between revisions of "RXN-10953"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] == * smiles: ** C(CC(C(=O)[O-])[N+])ONC(N)=O * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10953 RXN-10953] == * direction: ** LEFT-TO-RIGHT * common name: ** Inositol monophosphatase *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-UREIDOHOMOSERINE O-UREIDOHOMOSERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10953 RXN-10953] ==
* smiles:
+
* direction:
** C(CC(C(=O)[O-])[N+])ONC(N)=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N
+
 
* common name:
 
* common name:
** O-ureidohomoserine
+
** Inositol monophosphatase
* molecular weight:
+
* ec number:
** 177.16   
+
** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-6701]][c] '''=>''' 1 [[MYO-INOSITOL]][c] '''+''' 1 [[Pi]][c]
* [[RXN-9]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 1D-myo-inositol 5-monophosphate[c] '''=>''' 1 myo-inositol[c] '''+''' 1 phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-02_005670]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820483 91820483]
+
{{#set: common name=Inositol monophosphatase}}
* HMDB : HMDB12271
+
{{#set: ec number=EC-3.1.3.25}}
{{#set: smiles=C(CC(C(=O)[O-])[N+])ONC(N)=O}}
+
{{#set: gene associated=Ec-02_005670}}
{{#set: inchi key=InChIKey=SFYVZOSIAIZWQU-VKHMYHEASA-N}}
+
{{#set: in pathway=}}
{{#set: common name=O-ureidohomoserine}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=177.16    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: consumed by=RXN-10}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-9}}
+

Latest revision as of 19:52, 21 March 2018

Reaction RXN-10953

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Inositol monophosphatase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 1D-myo-inositol 5-monophosphate[c] => 1 myo-inositol[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links