Difference between revisions of "ITP"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.1.47-RXN 3.1.1.47-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-alkyl-2-acetylglyce...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * smiles: ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) |
+ | * inchi key: | ||
+ | ** InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** ITP |
− | * | + | * molecular weight: |
− | ** | + | ** 504.137 |
* Synonym(s): | * Synonym(s): | ||
+ | ** inosine triphosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN0-5073]] | |
− | + | * [[RXN0-6382]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-14120]] | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 132-06-9 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796439 25796439] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB00189 |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00081 C00081] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61402 61402] |
− | {{#set: | + | * BIGG : 33780 |
− | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J}} |
− | {{#set: | + | {{#set: common name=ITP}} |
+ | {{#set: molecular weight=504.137 }} | ||
+ | {{#set: common name=inosine triphosphate}} | ||
+ | {{#set: consumed by=RXN0-5073|RXN0-6382}} | ||
+ | {{#set: reversible reaction associated=RXN-14120}} |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite ITP
- smiles:
- C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=HAEJPQIATWHALX-KQYNXXCUSA-J
- common name:
- ITP
- molecular weight:
- 504.137
- Synonym(s):
- inosine triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP([O-])(=O)OP([O-])([O-])=O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.