Difference between revisions of "Ec-00 008890"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Gene == Gene Ec-00_008890 == * left end position: ** 14678311 * transcription direction: ** POSITIVE * right end position: ** 14681670 * centisome position: ** 77...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Gene Ec-00_008890 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** 14678311
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** XTP
+
** 14681670
−
* molecular weight:
+
* centisome position:
−
** 520.136    
+
** 77.472694    
 
* Synonym(s):
 
* Synonym(s):
−
** xanthosine 5' triphosphate
+
** Esi_0648_0004
 +
** Esi0648_0004
 +
** GST
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-1603]]
+
* Reaction: [[GSHTRAN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: left end position=14678311}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=14681670}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
+
{{#set: centisome position=77.472694   }}
−
* BIGG : 35735
+
{{#set: common name=Esi_0648_0004|Esi0648_0004|GST}}
−
* PUBCHEM:
+
{{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
−
* HMDB : HMDB00293
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
−
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
+
−
{{#set: common name=XTP}}
+
−
{{#set: molecular weight=520.136   }}
+
−
{{#set: common name=xanthosine 5' triphosphate}}
+
−
{{#set: consumed by=RXN0-1603}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-00_008890

  • left end position:
    • 14678311
  • transcription direction:
    • POSITIVE
  • right end position:
    • 14681670
  • centisome position:
    • 77.472694
  • Synonym(s):
    • Esi_0648_0004
    • Esi0648_0004
    • GST

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-00_008890&oldid=29883"