Difference between revisions of "XTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10953 RXN-10953] == * direction: ** LEFT-TO-RIGHT * common name: ** Inositol monophosphatase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10953 RXN-10953] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
 +
* inchi key:
 +
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
 
* common name:
 
* common name:
−
** Inositol monophosphatase
+
** XTP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25]
+
** 520.136   
 
* Synonym(s):
 
* Synonym(s):
 +
** xanthosine 5' triphosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN0-1603]]
−
** 1 [[CPD-6701]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[MYO-INOSITOL]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 1D-myo-inositol 5-monophosphate[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 myo-inositol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-02_005670]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: common name=Inositol monophosphatase}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
−
{{#set: ec number=EC-3.1.3.25}}
+
* CHEBI:
−
{{#set: gene associated=Ec-02_005670}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
−
{{#set: in pathway=}}
+
* BIGG : 35735
−
{{#set: reconstruction category=annotation}}
+
* PUBCHEM:
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
−
{{#set: reconstruction tool=pathwaytools}}
+
* HMDB : HMDB00293
 +
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
 +
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
 +
{{#set: common name=XTP}}
 +
{{#set: molecular weight=520.136    }}
 +
{{#set: common name=xanthosine 5' triphosphate}}
 +
{{#set: consumed by=RXN0-1603}}

Latest revision as of 19:52, 21 March 2018

Metabolite XTP

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
  • inchi key:
    • InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
  • common name:
    • XTP
  • molecular weight:
    • 520.136
  • Synonym(s):
    • xanthosine 5' triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=XTP&oldid=29899"