Difference between revisions of "RXN-9635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-octadec-2-enoyl-[acyl-c...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9635 RXN-9635] ==
* smiles:
+
* direction:
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
+
 
* common name:
 
* common name:
** 24-methylenecycloartanol
+
** trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
* molecular weight:
+
** Glucose/ribitol dehydrogenase
** 440.751   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
** 24(28)-methylenecycloartanol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-4021]]
+
** 1 [[NADH]][c] '''+''' 1 [[Octadec-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Stearoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 1 a trans-octadec-2-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a stearoyl-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5989 PWY-5989]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658794 90658794]
+
{{#set: common name=trans-octadec-2-enoyl-[acyl-carrier-protein] reductase}}
* LIGAND-CPD:
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
+
{{#set: ec number=EC-1.3.1.9}}
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
+
{{#set: gene associated=Ec-27_002470}}
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
+
{{#set: in pathway=PWY-5989}}
{{#set: common name=24-methylenecycloartanol}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: molecular weight=440.751    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}}
{{#set: common name=24(28)-methylenecycloartanol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: produced by=RXN-4021}}
+

Latest revision as of 19:52, 21 March 2018

Reaction RXN-9635

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-octadec-2-enoyl-[acyl-carrier-protein] reductase
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5989, stearate biosynthesis II (bacteria and plants): PWY-5989
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"trans-octadec-2-enoyl-[acyl-carrier-protein] reductase" cannot be used as a page name in this wiki.