Difference between revisions of "RXN66-181"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] == * smiles: ** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] == * direction: ** LEFT-TO-RIGHT * common name: ** Monooxygenase, FAD-binding...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13376 CPD-13376] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-181 RXN66-181] ==
* smiles:
+
* direction:
** C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N
+
 
* common name:
 
* common name:
** XXLG xyloglucan oligosaccharide
+
** Monooxygenase, FAD-binding
* molecular weight:
+
** Aromatic-ring hydroxylase-like
** 1225.073   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.14.14.1 EC-1.14.14.1]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12398]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-3481]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-3483]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 oxygen[c] '''+''' 1 bupropion[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 hydroxybupropion[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_010880]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-00_001320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-26_003280]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY66-241]], bupropion degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-241 PWY66-241]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940123 52940123]
+
{{#set: common name=Monooxygenase, FAD-binding}}
{{#set: smiles=C8(C(C(C(C(OCC7(OC(OC2(C(O)C(O)C(OC(COC1(C(C(C(CO1)O)O)O))2)OC5(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)OC4(C(C(C(C(O4)CO)O)O)O)))5)OC6(C(O)C(O)C(O)OC(CO)6))))C(O)C(O)C(O)7))O8)O)O)O)}}
+
{{#set: common name=Aromatic-ring hydroxylase-like}}
{{#set: inchi key=InChIKey=UJNIQUVNFJIFMG-IKGYADNMSA-N}}
+
{{#set: ec number=EC-1.14.14.1}}
{{#set: common name=XXLG xyloglucan oligosaccharide}}
+
{{#set: gene associated=Ec-01_010880|Ec-00_001320|Ec-26_003280}}
{{#set: molecular weight=1225.073    }}
+
{{#set: in pathway=PWY66-241}}
{{#set: consumed by=RXN-12398}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:52, 21 March 2018

Reaction RXN66-181

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Monooxygenase, FAD-binding
    • Aromatic-ring hydroxylase-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY66-241, bupropion degradation: PWY66-241
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links