Difference between revisions of "CPD-16483"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] == * smiles: ** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15348 RXN-15348] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16483 CPD-16483] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
 +
* common name:
 +
** α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1 [[HS]][c] '''=>''' 1 [[CPD-11281]][c] '''+''' 1 [[GLUTATHIONE]][c]
+
* [[RXN-15271]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 glutathione disulfide[c] '''+''' 1 hydrogen sulfide[c] '''=>''' 1 S-sulfanylglutathione[c] '''+''' 1 glutathione[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-5285]], sulfide oxidation III (persulfide dioxygenase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5285 PWY-5285]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)}}
{{#set: in pathway=PWY-5285}}
+
{{#set: common name=α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R}}
{{#set: reconstruction category=annotation}}
+
{{#set: produced by=RXN-15271}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:11, 21 March 2018

Metabolite CPD-16483

  • smiles:
    • CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)
  • common name:
    • α-N-acetylneuraminyl-2,6-β-D-galactosyl-(1→4)-N-acetyl-β-D-glucosaminyl-R
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC3(C(CC(C([O-])=O)(OCC1(C(O)C(O)C(O)C(O1)OC2(C(CO)OC(C(NC(C)=O)C(O)2)O[R])))O[CH]3C(O)C(O)CO)O)" cannot be used as a page name in this wiki.