Difference between revisions of "Ec-18 000810"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...")
(Created page with "Category:Gene == Gene Ec-18_000810 == * left end position: ** 784882 * transcription direction: ** POSITIVE * right end position: ** 795758 * centisome position: ** 15.931...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] ==
+
== Gene Ec-18_000810 ==
−
* smiles:
+
* left end position:
−
** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
+
** 784882
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** prolycopene
+
** 795758
−
* molecular weight:
+
* centisome position:
−
** 536.882    
+
** 15.931654    
 
* Synonym(s):
 
* Synonym(s):
−
** 7,9,9',7'-tetra-cis-lycopene
+
** Esi_0020_0111
−
** 9,9'-di-cis-ζ-carotene
+
** Esi0020_0111
−
** 7,9,9',7'-tetracis-lycopene
+
** PP2C
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.3.16-RXN]]
−
* [[RXN-11357]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[RXN-12242]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=784882}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=795758}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466]
+
{{#set: centisome position=15.931654   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0020_0111|Esi0020_0111|PP2C}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858]
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
* HMDB : HMDB35776
+
−
{{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}}
+
−
{{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}}
+
−
{{#set: common name=prolycopene}}
+
−
{{#set: molecular weight=536.882   }}
+
−
{{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}}
+
−
{{#set: produced by=RXN-11357}}
+
−
{{#set: reversible reaction associated=RXN-12242}}
+

Latest revision as of 19:52, 21 March 2018

Gene Ec-18_000810

  • left end position:
    • 784882
  • transcription direction:
    • POSITIVE
  • right end position:
    • 795758
  • centisome position:
    • 15.931654
  • Synonym(s):
    • Esi_0020_0111
    • Esi0020_0111
    • PP2C

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_000810&oldid=29971"