Difference between revisions of "S-1-PHENYLETHANOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MEVALONATE MEVALONATE] == * smiles: ** CC(O)(CCO)CC(=O)[O-] * inchi key: ** InChIKey=KJTLQQUUPV...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * smiles: ** CC(O)C1(C=CC=CC=1) * inchi key: ** InChIKe...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == |
* smiles: | * smiles: | ||
− | ** CC(O)( | + | ** CC(O)C1(C=CC=CC=1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N |
* common name: | * common name: | ||
− | ** ( | + | ** (S)-1-phenylethanol |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 122.166 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN-1302]] |
− | + | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443135 443135] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.391409.html 391409] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16346 16346] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=CC(O)( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11348 C11348] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(O)C1(C=CC=CC=1)}} |
− | {{#set: common name=( | + | {{#set: inchi key=InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N}} |
− | {{#set: molecular weight= | + | {{#set: common name=(S)-1-phenylethanol}} |
− | + | {{#set: molecular weight=122.166 }} | |
− | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=RXN-1302}} |
Latest revision as of 20:53, 21 March 2018
Contents
Metabolite S-1-PHENYLETHANOL
- smiles:
- CC(O)C1(C=CC=CC=1)
- inchi key:
- InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N
- common name:
- (S)-1-phenylethanol
- molecular weight:
- 122.166
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links