Difference between revisions of "PSERPHOSPHA-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * smiles: ** C(C(CC(C1(C(=CC=CC=1)N))=O)=O)([O-])=O * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERPHOSPHA-RXN PSERPHOSPHA-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** HAD-like domain...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERPHOSPHA-RXN PSERPHOSPHA-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** HAD-like domain |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.3 EC-3.1.3.3] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[Phosphoserines]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[Serines]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 L(or D)-O-phosphoserine[c] '''+''' 1 H+[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 serine[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-18_001570]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q58989 Q58989] |
− | * | + | ** [http://www.uniprot.org/uniprot/O25367 O25367] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JUR1 Q9JUR1] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9CHW3 Q9CHW3] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PIL4 Q9PIL4] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P44997 P44997] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0AGB0 P0AGB0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P42941 P42941] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q49823 Q49823] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O82796 O82796] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=HAD-like domain}} |
− | {{#set: | + | {{#set: ec number=EC-3.1.3.3}} |
− | {{#set: | + | {{#set: gene associated=Ec-18_001570}} |
− | {{#set: | + | {{#set: in pathway=}} |
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:11, 21 March 2018
Contents
Reaction PSERPHOSPHA-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- HAD-like domain
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Phosphoserines[c] + 1 PROTON[c] + 1 WATER[c] => 1 Pi[c] + 1 Serines[c]
- With common name(s):
- 1 L(or D)-O-phosphoserine[c] + 1 H+[c] + 1 H2O[c] => 1 phosphate[c] + 1 serine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-18_001570
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links