Difference between revisions of "L-CYSTATHIONINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19162 CPD-19162] == * smiles: ** CCCCCCC=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == * smiles: ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O * inchi...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTATHIONINE L-CYSTATHIONINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ILRYLPWNYFXEMH-WHFBIAKZSA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-cystathionine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 222.259 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cystathionine |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15130]] |
| + | * [[RXN-15131]] | ||
| + | * [[CYSTATHIONINE-BETA-LYASE-RXN]] | ||
| + | * [[RXN-14048]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[O-SUCCHOMOSERLYASE-RXN]] |
| + | * [[CYSPH-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | ||
| + | * [[CYSTATHIONASE-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles= | + | * CAS : 56-88-2 |
| − | {{#set: inchi key=InChIKey= | + | * BIGG : 39523 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: molecular weight= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243997 25243997] |
| − | {{#set: common name= | + | * HMDB : HMDB00099 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02291 C02291] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58161 58161] | ||
| + | * METABOLIGHTS : MTBLC58161 | ||
| + | {{#set: smiles=C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=ILRYLPWNYFXEMH-WHFBIAKZSA-N}} | ||
| + | {{#set: common name=L-cystathionine}} | ||
| + | {{#set: molecular weight=222.259 }} | ||
| + | {{#set: common name=cystathionine}} | ||
| + | {{#set: consumed by=RXN-15130|RXN-15131|CYSTATHIONINE-BETA-LYASE-RXN|RXN-14048}} | ||
| + | {{#set: produced by=O-SUCCHOMOSERLYASE-RXN|CYSPH-RXN}} | ||
| + | {{#set: reversible reaction associated=CYSTATHIONINE-BETA-SYNTHASE-RXN|CYSTATHIONASE-RXN}} | ||
Latest revision as of 19:53, 21 March 2018
Contents
Metabolite L-CYSTATHIONINE
- smiles:
- C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O
- inchi key:
- InChIKey=ILRYLPWNYFXEMH-WHFBIAKZSA-N
- common name:
- L-cystathionine
- molecular weight:
- 222.259
- Synonym(s):
- cystathionine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 56-88-2
- BIGG : 39523
- PUBCHEM:
- HMDB : HMDB00099
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC58161
"C(SCC(C([O-])=O)[N+])CC([N+])C([O-])=O" cannot be used as a page name in this wiki.
