Difference between revisions of "CPD-17328"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * smiles: ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J |
* common name: | * common name: | ||
| − | ** | + | ** (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1106.066 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17112]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17111]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581220 71581220] |
| − | * | + | * CHEBI: |
| − | {{#set: smiles=C( | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74087 74087] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: common name=(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1106.066 }} |
| − | {{#set: consumed by= | + | {{#set: common name=(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA}} |
| − | {{#set: produced by= | + | {{#set: consumed by=RXN-17112}} |
| + | {{#set: produced by=RXN-17111}} | ||
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-17328
- smiles:
- CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J
- common name:
- (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
- molecular weight:
- 1106.066
- Synonym(s):
- (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.
