Difference between revisions of "Ec-22 002380"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...")
(Created page with "Category:Gene == Gene Ec-22_002380 == * left end position: ** 2660626 * transcription direction: ** POSITIVE * right end position: ** 2672867 * centisome position: ** 58.9...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] ==
+
== Gene Ec-22_002380 ==
−
* smiles:
+
* left end position:
−
** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
+
** 2660626
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** betanidin
+
** 2672867
−
* molecular weight:
+
* centisome position:
−
** 386.317    
+
** 58.91749    
 
* Synonym(s):
 
* Synonym(s):
−
** betanidin radical
+
** Esi_0091_0010
−
** 2,6-Pyridinedicarboxylic acid
+
** Esi0091_0010
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-8635]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB00217
+
{{#set: left end position=2660626}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506]
+
{{#set: right end position=2672867}}
−
* CHEBI:
+
{{#set: centisome position=58.91749   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079]
+
{{#set: common name=Esi_0091_0010|Esi0091_0010}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539]
+
−
* HMDB : HMDB29407
+
−
{{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}}
+
−
{{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}}
+
−
{{#set: common name=betanidin}}
+
−
{{#set: molecular weight=386.317   }}
+
−
{{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}}
+
−
{{#set: consumed by=RXN-8635}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-22_002380

  • left end position:
    • 2660626
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2672867
  • centisome position:
    • 58.91749
  • Synonym(s):
    • Esi_0091_0010
    • Esi0091_0010

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_002380&oldid=30150"