Difference between revisions of "RXN-10705"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10705 RXN-10705] == * direction: ** LEFT-TO-RIGHT * common name: ** ClpP/crotonase-like domain...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10705 RXN-10705] ==
−
* smiles:
+
* direction:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
+
 
* common name:
 
* common name:
−
** docosahexaenoate
+
** ClpP/crotonase-like domain
−
* molecular weight:
+
** Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
−
** 327.486   
+
** enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
 
* Synonym(s):
 
* Synonym(s):
−
** docosahexaenoic acid
 
−
** DHA
 
−
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-16138]]
+
** 1 [[CPD-11526]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-11527]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 OPC4-trans-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 OPC4-3-hydroxyacyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-16_003560]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-16_001250]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-06_001380]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''10''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMFA01030185
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=ClpP/crotonase-like domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
+
{{#set: common name=Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ}}
−
* DRUGBANK : DB03756
+
{{#set: common name=enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase}}
−
* CHEBI:
+
{{#set: ec number=EC-4.2.1.17}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
+
{{#set: gene associated=Ec-16_003560|Ec-16_001250|Ec-06_001380|Ec-14_006530}}
−
* HMDB : HMDB02183
+
{{#set: in pathway=PWY-735}}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=docosahexaenoate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=327.486    }}
+
−
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
+
−
{{#set: produced by=RXN-16138}}
+

Latest revision as of 19:54, 21 March 2018

Reaction RXN-10705

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ClpP/crotonase-like domain
    • Beta-hydroxydecanoyl thiol ester dehydrase, FabA/FabZ
    • enoyl-Coenzyme A hydratase/3-hydroxyacyl Coenzyme A dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 OPC4-trans-2-enoyl-CoA[c] + 1 H2O[c] => 1 OPC4-3-hydroxyacyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 10 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10705&oldid=30165"