Difference between revisions of "CPD-8653"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == * smiles: ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8653 CPD-8653] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L |
* common name: | * common name: | ||
− | ** | + | ** betanidin |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 386.317 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** betanidin radical |
− | ** | + | ** 2,6-Pyridinedicarboxylic acid |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-8635]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | * | + | * DRUGBANK : DB00217 |
− | + | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245506 25245506] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=3079 3079] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(C | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08539 C08539] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB29407 |
− | {{#set: common name= | + | {{#set: smiles=C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L}} |
− | {{#set: common name= | + | {{#set: common name=betanidin}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=386.317 }} |
− | + | {{#set: common name=betanidin radical|2,6-Pyridinedicarboxylic acid}} | |
− | + | {{#set: consumed by=RXN-8635}} |
Latest revision as of 19:54, 21 March 2018
Contents
Metabolite CPD-8653
- smiles:
- C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)
- inchi key:
- InChIKey=XHJKHSXHWJCBLX-AAEUAGOBSA-L
- common name:
- betanidin
- molecular weight:
- 386.317
- Synonym(s):
- betanidin radical
- 2,6-Pyridinedicarboxylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=[N+]1(C(C([O-])=O)CC2(=C1C=C(O)C(O)=C2)))C=C3(C=C(C(=O)[O-])NC(C([O-])=O)C3)" cannot be used as a page name in this wiki.