Difference between revisions of "CPD-10244"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-15_000900 == * Synonym(s): ** Esi_0012_0022 ** Esi0012_0022 == Reactions associated == * ATPASE-RXN ** pantograph-aragem == Pathways...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == |
| + | * smiles: | ||
| + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M | ||
| + | * common name: | ||
| + | ** docosahexaenoate | ||
| + | * molecular weight: | ||
| + | ** 327.486 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** docosahexaenoic acid |
| − | ** | + | ** DHA |
| + | ** all-cis-docosa-4,7,10,13,16,19-hexaenoate | ||
| + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate | ||
| + | ** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-16138]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIPID_MAPS : LMFA01030185 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925] | ||
| + | * DRUGBANK : DB03756 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016] | ||
| + | * HMDB : HMDB02183 | ||
| + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}} | ||
| + | {{#set: common name=docosahexaenoate}} | ||
| + | {{#set: molecular weight=327.486 }} | ||
| + | {{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}} | ||
| + | {{#set: produced by=RXN-16138}} | ||
Latest revision as of 20:54, 21 March 2018
Contents
Metabolite CPD-10244
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
- inchi key:
- InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
- common name:
- docosahexaenoate
- molecular weight:
- 327.486
- Synonym(s):
- docosahexaenoic acid
- DHA
- all-cis-docosa-4,7,10,13,16,19-hexaenoate
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-" cannot be used as a page name in this wiki.
