Difference between revisions of "Ec-04 004550"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)C...")
(Created page with "Category:Gene == Gene Ec-04_004550 == * Synonym(s): ** Esi_0044_0020 ** Esi0044_0020 ** LRR-PK == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13757 CPD-13757] ==
+
== Gene Ec-04_004550 ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
* inchi key:
+
** InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J
+
* common name:
+
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA
+
* molecular weight:
+
** 1001.785   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0044_0020
 +
** Esi0044_0020
 +
** LRR-PK
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-12750]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0044_0020|Esi0044_0020|LRR-PK}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657574 90657574]
+
{{#set: reaction associated=RXN-8443}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: pathway associated=PWY-5381}}
{{#set: inchi key=InChIKey=GXYIOJONRQGUCV-SWBALSFASA-J}}
+
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-hydroxypropanoyl-CoA}}
+
{{#set: molecular weight=1001.785    }}
+
{{#set: consumed by=RXN-12750}}
+

Latest revision as of 19:54, 21 March 2018

Gene Ec-04_004550

  • Synonym(s):
    • Esi_0044_0020
    • Esi0044_0020
    • LRR-PK

Reactions associated

Pathways associated

External links