Difference between revisions of "DCTP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_004820 == * left end position: ** 4627323 * transcription direction: ** NEGATIVE * right end position: ** 4638537 * centisome position: ** 69.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-08_004820 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
−
* left end position:
+
* smiles:
−
** 4627323
+
** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
−
* right end position:
+
* common name:
−
** 4638537
+
** dCTP
−
* centisome position:
+
* molecular weight:
−
** 69.09478    
+
** 463.127    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0466_0003
+
** 2'-deoxycytidine-5'-triphosphate
−
** Esi0466_0003
+
** deoxycytidine-triphosphate
−
** MEP18
+
** deoxy-CTP
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-9839]]
+
* [[RXN-14216]]
−
** esiliculosus_genome
+
* [[RXN-14198]]
−
***automated-name-match
+
== Reaction(s) known to produce the compound ==
−
== Pathways associated ==
+
* [[RXN0-723]]
−
* [[PWY-6082]]
+
* [[DCDPKIN-RXN]]
−
* [[PWY-6073]]
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4627323}}
+
* CAS : 2056-98-6
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=4638537}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665]
−
{{#set: centisome position=69.09478   }}
+
* HMDB : HMDB00998
−
{{#set: common name=Esi_0466_0003|Esi0466_0003|MEP18}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=RXN-9839}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458]
−
{{#set: pathway associated=PWY-6082|PWY-6073}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481]
 +
* BIGG : 35027
 +
{{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
 +
{{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}}
 +
{{#set: common name=dCTP}}
 +
{{#set: molecular weight=463.127   }}
 +
{{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}}
 +
{{#set: consumed by=RXN-14216|RXN-14198}}
 +
{{#set: produced by=RXN0-723|DCDPKIN-RXN}}

Latest revision as of 19:55, 21 March 2018

Metabolite DCTP

  • smiles:
    • C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
  • common name:
    • dCTP
  • molecular weight:
    • 463.127
  • Synonym(s):
    • 2'-deoxycytidine-5'-triphosphate
    • deoxycytidine-triphosphate
    • deoxy-CTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 2056-98-6
  • PUBCHEM:
  • HMDB : HMDB00998
  • LIGAND-CPD:
  • CHEBI:
  • BIGG : 35027
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DCTP&oldid=30258"